C18H19NO3 — CID 162859057
ethyl (2S)-4-benzyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate (PubChem CID 162859057) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl (2S)-4-benzyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl (2S)-4-benzyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 162859057 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl (2S)-4-benzyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(Cc2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C18H19NO3/c1-2-21-18(20)17-13-19(12-14-8-4-3-5-9-14)15-10-6-7-11-16(15)22-17/h3-11,17H,2,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | LFSYUHOUKZYIHP-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |