About methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate
methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate (PubChem CID 22593931) has the molecular formula C28H29NO5
and a molecular weight of 459.54 g/mol. Its IUPAC name is methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate |
| PubChem CID | 22593931 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate |
| SMILES | CCO/C(=C\c1ccc(OCC2CN(Cc3ccccc3)c3ccccc3O2)cc1)C(=O)OC |
| InChI | InChI=1S/C28H29NO5/c1-3-32-27(28(30)31-2)17-21-13-15-23(16-14-21)33-20-24-19-29(18-22-9-5-4-6-10-22)25-11-7-8-12-26(25)34-24/h4-17,24H,3,18-20H2,1-2H3/b27-17- |
| InChIKey | WCPBWICJSJJGGA-PKAZHMFMSA-N |
| XLogP | 5.08 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate?
The IUPAC name of methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate (CID 22593931) is methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate.
What is the SMILES notation for methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate?
The canonical SMILES for methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate is CCO/C(=C\c1ccc(OCC2CN(Cc3ccccc3)c3ccccc3O2)cc1)C(=O)OC.
What is the InChIKey of methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate?
The InChIKey is WCPBWICJSJJGGA-PKAZHMFMSA-N. The full InChI is InChI=1S/C28H29NO5/c1-3-32-27(28(30)31-2)17-21-13-15-23(16-14-21)33-20-24-19-29(18-22-9-5-4-6-10-22)25-11-7-8-12-26(25)34-24/h4-17,24H,3,18-20H2,1-2H3/b27-17-.
What are the key properties of methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate?
methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate has a molecular weight of 459.54 g/mol, XLogP of 5.08, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-[4-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]-2-ethoxyprop-2-enoate is sourced from PubChem (CID 22593931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).