C27H27NO5 — CID 140524747
ethyl (E)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-phenoxyprop-2-enoate (PubChem CID 140524747) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl (E)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-phenoxyprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-phenoxyprop-2-enoate |
|---|---|
| PubChem CID | 140524747 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | ethyl (E)-3-[4-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethoxy]phenyl]-2-phenoxyprop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(OCCN2CCOc3ccccc32)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C27H27NO5/c1-2-30-27(29)26(33-23-8-4-3-5-9-23)20-21-12-14-22(15-13-21)31-18-16-28-17-19-32-25-11-7-6-10-24(25)28/h3-15,20H,2,16-19H2,1H3/b26-20+ |
| InChIKey | FDBUMAZMKYPOHP-LHLOQNFPSA-N |
| XLogP | 4.95 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|