C14H19NO3 — CID 112706613
ethyl 3-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)propanoate (PubChem CID 112706613) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)propanoate.
| Compound Name | ethyl 3-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)propanoate |
|---|---|
| PubChem CID | 112706613 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethyl 3-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)propanoate |
| SMILES | CCOC(=O)CCN1CCCOc2ccccc21 |
| InChI | InChI=1S/C14H19NO3/c1-2-17-14(16)8-10-15-9-5-11-18-13-7-4-3-6-12(13)15/h3-4,6-7H,2,5,8-11H2,1H3 |
| InChIKey | PRXRKQOQPWGPIU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |