methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate

C11H13NO3 — CID 66829621

IUPACmethyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate
SMILESCOC(=O)N1CCCOc2ccccc21
InChIInChI=1S/C11H13NO3/c1-14-11(13)12-7-4-8-15-10-6-3-2-5-9(10)12/h2-3,5-6H,4,7-8H2,1H3
InChIKeyDOCHGAFHPKOYMD-UHFFFAOYSA-N
MW207.23 g/mol
LogP2.04
Rot. Bonds

About methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate

methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 66829621) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate.

Molecular Properties

Compound Namemethyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate
PubChem CID66829621
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Namemethyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate
SMILESCOC(=O)N1CCCOc2ccccc21
InChIInChI=1S/C11H13NO3/c1-14-11(13)12-7-4-8-15-10-6-3-2-5-9(10)12/h2-3,5-6H,4,7-8H2,1H3
InChIKeyDOCHGAFHPKOYMD-UHFFFAOYSA-N
XLogP2.04
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 52.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
The IUPAC name of methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate (CID 66829621) is methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
What is the SMILES notation for methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
The canonical SMILES for methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate is COC(=O)N1CCCOc2ccccc21.
What is the InChIKey of methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
The InChIKey is DOCHGAFHPKOYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-11(13)12-7-4-8-15-10-6-3-2-5-9(10)12/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate is sourced from PubChem (CID 66829621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).