C11H13NO3 — CID 66829621
methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 66829621) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
| Compound Name | methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
|---|---|
| PubChem CID | 66829621 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl 3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| SMILES | COC(=O)N1CCCOc2ccccc21 |
| InChI | InChI=1S/C11H13NO3/c1-14-11(13)12-7-4-8-15-10-6-3-2-5-9(10)12/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | DOCHGAFHPKOYMD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |