C13H15NO2 — CID 112645715
(E)-1-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)but-2-en-1-one (PubChem CID 112645715) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)but-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 112645715 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCCOc2ccccc21 |
| InChI | InChI=1S/C13H15NO2/c1-2-6-13(15)14-9-5-10-16-12-8-4-3-7-11(12)14/h2-4,6-8H,5,9-10H2,1H3/b6-2+ |
| InChIKey | HHYIFWKMFZALIZ-QHHAFSJGSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|