C14H20N2O2 — CID 116657610
N,N-diethyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxamide (PubChem CID 116657610) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N,N-diethyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxamide.
| Compound Name | N,N-diethyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxamide |
|---|---|
| PubChem CID | 116657610 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N,N-diethyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCCOc2ccccc21 |
| InChI | InChI=1S/C14H20N2O2/c1-3-15(4-2)14(17)16-10-7-11-18-13-9-6-5-8-12(13)16/h5-6,8-9H,3-4,7,10-11H2,1-2H3 |
| InChIKey | JYFXTVWBQAYXOJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |