C14H21N3O — CID 115641411
N,N-diethyl-4-methyl-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 115641411) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N,N-diethyl-4-methyl-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | N,N-diethyl-4-methyl-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 115641411 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N,N-diethyl-4-methyl-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C14H21N3O/c1-4-16(5-2)14(18)17-11-10-15(3)12-8-6-7-9-13(12)17/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | RMSZLZLVPXGYGK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |