About 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide
4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide (PubChem CID 63776473) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide |
| PubChem CID | 63776473 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide |
| SMILES | CN1CCN(C(=O)NN)c2ccccc21 |
| InChI | InChI=1S/C10H14N4O/c1-13-6-7-14(10(15)12-11)9-5-3-2-4-8(9)13/h2-5H,6-7,11H2,1H3,(H,12,15) |
| InChIKey | BSYUEJHGRRLWLQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide?
The IUPAC name of 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide (CID 63776473) is 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide.
What is the SMILES notation for 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide?
The canonical SMILES for 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide is CN1CCN(C(=O)NN)c2ccccc21.
What is the InChIKey of 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide?
The InChIKey is BSYUEJHGRRLWLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-13-6-7-14(10(15)12-11)9-5-3-2-4-8(9)13/h2-5H,6-7,11H2,1H3,(H,12,15).
What are the key properties of 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide?
4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide has a molecular weight of 206.25 g/mol, XLogP of 0.53, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydroquinoxaline-1-carbohydrazide is sourced from PubChem (CID 63776473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).