C11H13BrN2O — CID 63778569
2-bromo-1-(4-methyl-2,3-dihydroquinoxalin-1-yl)ethanone (PubChem CID 63778569) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is 2-bromo-1-(4-methyl-2,3-dihydroquinoxalin-1-yl)ethanone.
| Compound Name | 2-bromo-1-(4-methyl-2,3-dihydroquinoxalin-1-yl)ethanone |
|---|---|
| PubChem CID | 63778569 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-bromo-1-(4-methyl-2,3-dihydroquinoxalin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CBr)c2ccccc21 |
| InChI | InChI=1S/C11H13BrN2O/c1-13-6-7-14(11(15)8-12)10-5-3-2-4-9(10)13/h2-5H,6-8H2,1H3 |
| InChIKey | COTWEXABJPJIKG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|