C17H18N2OS — CID 107030058
1-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(4-sulfanylphenyl)ethanone (PubChem CID 107030058) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(4-sulfanylphenyl)ethanone.
| Compound Name | 1-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(4-sulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 107030058 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(4-sulfanylphenyl)ethanone |
| SMILES | CN1CCN(C(=O)Cc2ccc(S)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H18N2OS/c1-18-10-11-19(16-5-3-2-4-15(16)18)17(20)12-13-6-8-14(21)9-7-13/h2-9,21H,10-12H2,1H3 |
| InChIKey | FWBCVEMFIQEWGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|