C13H19N3O — CID 110747567
4-methyl-N-propyl-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 110747567) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-methyl-N-propyl-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | 4-methyl-N-propyl-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 110747567 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-methyl-N-propyl-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | CCCNC(=O)N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C13H19N3O/c1-3-8-14-13(17)16-10-9-15(2)11-6-4-5-7-12(11)16/h4-7H,3,8-10H2,1-2H3,(H,14,17) |
| InChIKey | BCNSWQFWSPLSGP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |