C13H18N2O — CID 2987329
N,N-diethyl-2,3-dihydroindole-1-carboxamide (PubChem CID 2987329) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N,N-diethyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N,N-diethyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 2987329 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N,N-diethyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-3-14(4-2)13(16)15-10-9-11-7-5-6-8-12(11)15/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | ZWMBWNRAUWHCID-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |