C15H20N2O3 — CID 61189508
2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid (PubChem CID 61189508) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 61189508 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H20N2O3/c1-3-11(2)17(10-14(18)19)15(20)16-9-8-12-6-4-5-7-13(12)16/h4-7,11H,3,8-10H2,1-2H3,(H,18,19) |
| InChIKey | DVRYQZCOIBDKQD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |