2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid

C15H20N2O3 — CID 61189508

IUPAC2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)N1CCc2ccccc21
InChIInChI=1S/C15H20N2O3/c1-3-11(2)17(10-14(18)19)15(20)16-9-8-12-6-4-5-7-13(12)16/h4-7,11H,3,8-10H2,1-2H3,(H,18,19)
InChIKeyDVRYQZCOIBDKQD-UHFFFAOYSA-N
MW276.34 g/mol
LogP2.35
Rot. Bonds4

About 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid

2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid (PubChem CID 61189508) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid
PubChem CID61189508
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)N1CCc2ccccc21
InChIInChI=1S/C15H20N2O3/c1-3-11(2)17(10-14(18)19)15(20)16-9-8-12-6-4-5-7-13(12)16/h4-7,11H,3,8-10H2,1-2H3,(H,18,19)
InChIKeyDVRYQZCOIBDKQD-UHFFFAOYSA-N
XLogP2.35
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
The IUPAC name of 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid (CID 61189508) is 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid is CCC(C)N(CC(=O)O)C(=O)N1CCc2ccccc21.
What is the InChIKey of 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
The InChIKey is DVRYQZCOIBDKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-3-11(2)17(10-14(18)19)15(20)16-9-8-12-6-4-5-7-13(12)16/h4-7,11H,3,8-10H2,1-2H3,(H,18,19).
What are the key properties of 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid has a molecular weight of 276.34 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butan-2-yl(2,3-dihydroindole-1-carbonyl)amino]acetic acid is sourced from PubChem (CID 61189508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).