2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid

C16H20N2O3 — CID 61189507

IUPAC2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid
SMILESO=C(O)CN(C(=O)N1CCc2ccccc21)C1CCCC1
InChIInChI=1S/C16H20N2O3/c19-15(20)11-18(13-6-2-3-7-13)16(21)17-10-9-12-5-1-4-8-14(12)17/h1,4-5,8,13H,2-3,6-7,9-11H2,(H,19,20)
InChIKeyCJRMDQILNRCLSD-UHFFFAOYSA-N
MW288.35 g/mol
LogP2.50
Rot. Bonds3

About 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid

2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid (PubChem CID 61189507) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid
PubChem CID61189507
Molecular FormulaC16H20N2O3
Molecular Weight288.35 g/mol
Exact Mass288.15
IUPAC Name2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid
SMILESO=C(O)CN(C(=O)N1CCc2ccccc21)C1CCCC1
InChIInChI=1S/C16H20N2O3/c19-15(20)11-18(13-6-2-3-7-13)16(21)17-10-9-12-5-1-4-8-14(12)17/h1,4-5,8,13H,2-3,6-7,9-11H2,(H,19,20)
InChIKeyCJRMDQILNRCLSD-UHFFFAOYSA-N
XLogP2.50
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.35
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
The IUPAC name of 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid (CID 61189507) is 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid is O=C(O)CN(C(=O)N1CCc2ccccc21)C1CCCC1.
What is the InChIKey of 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
The InChIKey is CJRMDQILNRCLSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c19-15(20)11-18(13-6-2-3-7-13)16(21)17-10-9-12-5-1-4-8-14(12)17/h1,4-5,8,13H,2-3,6-7,9-11H2,(H,19,20).
What are the key properties of 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid?
2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid has a molecular weight of 288.35 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl(2,3-dihydroindole-1-carbonyl)amino]acetic acid is sourced from PubChem (CID 61189507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).