C11H14N2O — CID 20806588
2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 20806588) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 20806588 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | CC(N)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C11H14N2O/c1-8(12)11(14)13-7-6-9-4-2-3-5-10(9)13/h2-5,8H,6-7,12H2,1H3 |
| InChIKey | XZHRLYUEEHDTFI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |