C17H24N3O+ — CID 2533731
(2S)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 2533731) has the molecular formula C17H24N3O+ and a molecular weight of 286.40 g/mol. Its IUPAC name is (2S)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | (2S)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 2533731 |
| Molecular Formula | C17H24N3O+ |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (2S)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | C[C@@H](C(=O)N1CCc2ccccc21)[N+]12CCN(CC1)CC2 |
| InChI | InChI=1S/C17H24N3O/c1-14(20-11-8-18(9-12-20)10-13-20)17(21)19-7-6-15-4-2-3-5-16(15)19/h2-5,14H,6-13H2,1H3/q+1/t14-/m0/s1 |
| InChIKey | QGUPMVNGNLJFQN-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|