C20H23NO — CID 135054054
(2S)-1-(2,3-dihydroindol-1-yl)-4-methyl-2-phenylpentan-1-one (PubChem CID 135054054) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (2S)-1-(2,3-dihydroindol-1-yl)-4-methyl-2-phenylpentan-1-one.
| Compound Name | (2S)-1-(2,3-dihydroindol-1-yl)-4-methyl-2-phenylpentan-1-one |
|---|---|
| PubChem CID | 135054054 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2S)-1-(2,3-dihydroindol-1-yl)-4-methyl-2-phenylpentan-1-one |
| SMILES | CC(C)C[C@H](C(=O)N1CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H23NO/c1-15(2)14-18(16-8-4-3-5-9-16)20(22)21-13-12-17-10-6-7-11-19(17)21/h3-11,15,18H,12-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | DIRSDMXJVVSHPZ-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |