S-ethyl 2,3-dihydroindole-1-carbothioate

C11H13NOS — CID 46914254

IUPACS-ethyl 2,3-dihydroindole-1-carbothioate
SMILESCCSC(=O)N1CCc2ccccc21
InChIInChI=1S/C11H13NOS/c1-2-14-11(13)12-8-7-9-5-3-4-6-10(9)12/h3-6H,2,7-8H2,1H3
InChIKeyRLLMBZYIJXQOEK-UHFFFAOYSA-N
MW207.30 g/mol
LogP2.92
Rot. Bonds1

About S-ethyl 2,3-dihydroindole-1-carbothioate

S-ethyl 2,3-dihydroindole-1-carbothioate (PubChem CID 46914254) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is S-ethyl 2,3-dihydroindole-1-carbothioate.

Molecular Properties

Compound NameS-ethyl 2,3-dihydroindole-1-carbothioate
PubChem CID46914254
Molecular FormulaC11H13NOS
Molecular Weight207.30 g/mol
Exact Mass207.07
IUPAC NameS-ethyl 2,3-dihydroindole-1-carbothioate
SMILESCCSC(=O)N1CCc2ccccc21
InChIInChI=1S/C11H13NOS/c1-2-14-11(13)12-8-7-9-5-3-4-6-10(9)12/h3-6H,2,7-8H2,1H3
InChIKeyRLLMBZYIJXQOEK-UHFFFAOYSA-N
XLogP2.92
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.30
LogP ≤ 52.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-ethyl 2,3-dihydroindole-1-carbothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-ethyl 2,3-dihydroindole-1-carbothioate?
The IUPAC name of S-ethyl 2,3-dihydroindole-1-carbothioate (CID 46914254) is S-ethyl 2,3-dihydroindole-1-carbothioate.
What is the SMILES notation for S-ethyl 2,3-dihydroindole-1-carbothioate?
The canonical SMILES for S-ethyl 2,3-dihydroindole-1-carbothioate is CCSC(=O)N1CCc2ccccc21.
What is the InChIKey of S-ethyl 2,3-dihydroindole-1-carbothioate?
The InChIKey is RLLMBZYIJXQOEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-2-14-11(13)12-8-7-9-5-3-4-6-10(9)12/h3-6H,2,7-8H2,1H3.
What are the key properties of S-ethyl 2,3-dihydroindole-1-carbothioate?
S-ethyl 2,3-dihydroindole-1-carbothioate has a molecular weight of 207.30 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 2,3-dihydroindole-1-carbothioate is sourced from PubChem (CID 46914254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).