C10H10ClNO3S — CID 99980595
2-(2,3-dihydroindol-1-yl)-2-oxoethanesulfonyl chloride (PubChem CID 99980595) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-2-oxoethanesulfonyl chloride.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-2-oxoethanesulfonyl chloride |
|---|---|
| PubChem CID | 99980595 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-2-oxoethanesulfonyl chloride |
| SMILES | O=C(CS(=O)(=O)Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C10H10ClNO3S/c11-16(14,15)7-10(13)12-6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2 |
| InChIKey | NLCNAPFYYJLCPA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |