C11H14N4O — CID 110930545
2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine (PubChem CID 110930545) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine |
|---|---|
| PubChem CID | 110930545 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine |
| SMILES | NC(N)=NCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C11H14N4O/c12-11(13)14-7-10(16)15-6-5-8-3-1-2-4-9(8)15/h1-4H,5-7H2,(H4,12,13,14) |
| InChIKey | SSIBEJMDUVRQDZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|