C19H23N7O — CID 119121329
N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119121329) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119121329 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\CC(=O)N1CCc2ccccc21)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H23N7O/c20-18(24-10-12-25(13-11-24)19-21-7-3-8-22-19)23-14-17(27)26-9-6-15-4-1-2-5-16(15)26/h1-5,7-8H,6,9-14H2,(H2,20,23) |
| InChIKey | WJOHOGAEXFYNKU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|