C15H18N6 — CID 62362264
N'-phenyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 62362264) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is N'-phenyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-phenyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62362264 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N'-phenyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ccccc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C15H18N6/c16-14(19-13-5-2-1-3-6-13)20-9-11-21(12-10-20)15-17-7-4-8-18-15/h1-8H,9-12H2,(H2,16,19) |
| InChIKey | YSMFUQPYSBDMBL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|