C18H22N8O2 — CID 3412822
1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 3412822) has the molecular formula C18H22N8O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 3412822 |
| Molecular Formula | C18H22N8O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2ncccn2)CC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H22N8O2/c27-15(23-7-11-25(12-8-23)17-19-3-1-4-20-17)16(28)24-9-13-26(14-10-24)18-21-5-2-6-22-18/h1-6H,7-14H2 |
| InChIKey | VFJHMNHVAXFBGF-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 98.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|