C12H14N6O2 — CID 43315831
N-(cyanomethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide (PubChem CID 43315831) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(cyanomethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(cyanomethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 43315831 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-(cyanomethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
| SMILES | N#CCNC(=O)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C12H14N6O2/c13-2-5-14-10(19)11(20)17-6-8-18(9-7-17)12-15-3-1-4-16-12/h1,3-4H,5-9H2,(H,14,19) |
| InChIKey | FDIULHTVZFLNTQ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|