C14H21N5O4 — CID 108530043
N-(2,2-dimethoxyethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide (PubChem CID 108530043) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 108530043 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
| SMILES | COC(CNC(=O)C(=O)N1CCN(c2ncccn2)CC1)OC |
| InChI | InChI=1S/C14H21N5O4/c1-22-11(23-2)10-17-12(20)13(21)18-6-8-19(9-7-18)14-15-4-3-5-16-14/h3-5,11H,6-10H2,1-2H3,(H,17,20) |
| InChIKey | VZIHFHPOHDMIHW-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|