C13H16Cl2N4O — CID 41138717
[(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 41138717) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 41138717 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | C[C@@]1(C(=O)N2CCN(c3ncccn3)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H16Cl2N4O/c1-12(9-13(12,14)15)10(20)18-5-7-19(8-6-18)11-16-3-2-4-17-11/h2-4H,5-9H2,1H3/t12-/m0/s1 |
| InChIKey | JKJGVHKCYRULTA-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|