C15H25Cl2N5O2 — CID 119827990
(4-methoxypiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119827990) has the molecular formula C15H25Cl2N5O2 and a molecular weight of 378.30 g/mol. Its IUPAC name is (4-methoxypiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (4-methoxypiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119827990 |
| Molecular Formula | C15H25Cl2N5O2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (4-methoxypiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | COC1(C(=O)N2CCN(c3ncccn3)CC2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H23N5O2.2ClH/c1-22-15(3-7-16-8-4-15)13(21)19-9-11-20(12-10-19)14-17-5-2-6-18-14;;/h2,5-6,16H,3-4,7-12H2,1H3;2*1H |
| InChIKey | XBRONYFHXLTOTF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |