C17H23N7O — CID 120937777
(4-pyrazol-1-ylpiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 120937777) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is (4-pyrazol-1-ylpiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (4-pyrazol-1-ylpiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120937777 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4-pyrazol-1-ylpiperidin-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(N1CCN(c2ncccn2)CC1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C17H23N7O/c25-15(17(3-8-18-9-4-17)24-10-2-7-21-24)22-11-13-23(14-12-22)16-19-5-1-6-20-16/h1-2,5-7,10,18H,3-4,8-9,11-14H2 |
| InChIKey | CYIUXSDONYSSHO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |