C18H26FN3O3 — CID 119888933
[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-(4-methoxypiperidin-4-yl)methanone (PubChem CID 119888933) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-(4-methoxypiperidin-4-yl)methanone.
| Compound Name | [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-(4-methoxypiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 119888933 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-(4-methoxypiperidin-4-yl)methanone |
| SMILES | COc1cc(F)ccc1N1CCN(C(=O)C2(OC)CCNCC2)CC1 |
| InChI | InChI=1S/C18H26FN3O3/c1-24-16-13-14(19)3-4-15(16)21-9-11-22(12-10-21)17(23)18(25-2)5-7-20-8-6-18/h3-4,13,20H,5-12H2,1-2H3 |
| InChIKey | VXFYFYRWIIVDHK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |