C17H24FN3O2 — CID 119888881
[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-piperidin-3-ylmethanone (PubChem CID 119888881) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-piperidin-3-ylmethanone.
| Compound Name | [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 119888881 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-piperidin-3-ylmethanone |
| SMILES | COc1cc(F)ccc1N1CCN(C(=O)C2CCCNC2)CC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-23-16-11-14(18)4-5-15(16)20-7-9-21(10-8-20)17(22)13-3-2-6-19-12-13/h4-5,11,13,19H,2-3,6-10,12H2,1H3 |
| InChIKey | NXKAWTUVTHIIPR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |