C16H24Cl2FN3O2 — CID 119888948
[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-pyrrolidin-3-ylmethanone;dihydrochloride (PubChem CID 119888948) has the molecular formula C16H24Cl2FN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-pyrrolidin-3-ylmethanone;dihydrochloride.
| Compound Name | [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-pyrrolidin-3-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119888948 |
| Molecular Formula | C16H24Cl2FN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]-pyrrolidin-3-ylmethanone;dihydrochloride |
| SMILES | COc1cc(F)ccc1N1CCN(C(=O)C2CCNC2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H22FN3O2.2ClH/c1-22-15-10-13(17)2-3-14(15)19-6-8-20(9-7-19)16(21)12-4-5-18-11-12;;/h2-3,10,12,18H,4-9,11H2,1H3;2*1H |
| InChIKey | QJTIKWVMHPUUJM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |