C14H17Cl2N3O — CID 43020731
(2,2-dichloro-1-methylcyclopropyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone (PubChem CID 43020731) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is (2,2-dichloro-1-methylcyclopropyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone.
| Compound Name | (2,2-dichloro-1-methylcyclopropyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 43020731 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (2,2-dichloro-1-methylcyclopropyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| SMILES | CC1(C(=O)N2CCN(c3ccncc3)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C14H17Cl2N3O/c1-13(10-14(13,15)16)12(20)19-8-6-18(7-9-19)11-2-4-17-5-3-11/h2-5H,6-10H2,1H3 |
| InChIKey | ZUUTZCVXUVXGNM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|