C16H20Cl2N2O2 — CID 41038064
[(1S)-2,2-dichloro-1-methylcyclopropyl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 41038064) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is [(1S)-2,2-dichloro-1-methylcyclopropyl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 41038064 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(N2CCN(C(=O)[C@]3(C)CC3(Cl)Cl)CC2)c1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-15(11-16(15,17)18)14(21)20-8-6-19(7-9-20)12-4-3-5-13(10-12)22-2/h3-5,10H,6-9,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | ZJWAHWHRLQTVER-HNNXBMFYSA-N |
| XLogP | 2.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|