C24H30N2O2 — CID 46562920
(4-cyclohexylphenyl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 46562920) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (4-cyclohexylphenyl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (4-cyclohexylphenyl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46562920 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (4-cyclohexylphenyl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(N2CCN(C(=O)c3ccc(C4CCCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-28-23-9-5-8-22(18-23)25-14-16-26(17-15-25)24(27)21-12-10-20(11-13-21)19-6-3-2-4-7-19/h5,8-13,18-19H,2-4,6-7,14-17H2,1H3 |
| InChIKey | VSQKDNCXXXTGIA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |