C24H27N2O3- — CID 2051794
3-[4-(4-cyclohexylphenyl)piperazine-1-carbonyl]benzoate (PubChem CID 2051794) has the molecular formula C24H27N2O3- and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-[4-(4-cyclohexylphenyl)piperazine-1-carbonyl]benzoate.
| Compound Name | 3-[4-(4-cyclohexylphenyl)piperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 2051794 |
| Molecular Formula | C24H27N2O3- |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-[4-(4-cyclohexylphenyl)piperazine-1-carbonyl]benzoate |
| SMILES | O=C([O-])c1cccc(C(=O)N2CCN(c3ccc(C4CCCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H28N2O3/c27-23(20-7-4-8-21(17-20)24(28)29)26-15-13-25(14-16-26)22-11-9-19(10-12-22)18-5-2-1-3-6-18/h4,7-12,17-18H,1-3,5-6,13-16H2,(H,28,29)/p-1 |
| InChIKey | FCZHXCMBEFVABU-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|