C24H29N3O2 — CID 109052171
N-cyclohexyl-3-(4-phenylpiperazine-1-carbonyl)benzamide (PubChem CID 109052171) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-cyclohexyl-3-(4-phenylpiperazine-1-carbonyl)benzamide.
| Compound Name | N-cyclohexyl-3-(4-phenylpiperazine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109052171 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-cyclohexyl-3-(4-phenylpiperazine-1-carbonyl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(C(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(25-21-10-3-1-4-11-21)19-8-7-9-20(18-19)24(29)27-16-14-26(15-17-27)22-12-5-2-6-13-22/h2,5-9,12-13,18,21H,1,3-4,10-11,14-17H2,(H,25,28) |
| InChIKey | UBTOCFWCSIIQFX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |