C27H36N4O3 — CID 42166830
N-cycloheptyl-4-oxo-5-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylpyridine-3-carboxamide (PubChem CID 42166830) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-cycloheptyl-4-oxo-5-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylpyridine-3-carboxamide.
| Compound Name | N-cycloheptyl-4-oxo-5-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 42166830 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-cycloheptyl-4-oxo-5-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)n1cc(C(=O)NC2CCCCCC2)c(=O)c(C(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H36N4O3/c1-20(2)31-18-23(26(33)28-21-10-6-3-4-7-11-21)25(32)24(19-31)27(34)30-16-14-29(15-17-30)22-12-8-5-9-13-22/h5,8-9,12-13,18-21H,3-4,6-7,10-11,14-17H2,1-2H3,(H,28,33) |
| InChIKey | LMIWLMBRRLGYJU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |