C17H25N3O — CID 28748940
N-cyclohexyl-3-piperazin-1-ylbenzamide (PubChem CID 28748940) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-cyclohexyl-3-piperazin-1-ylbenzamide.
| Compound Name | N-cyclohexyl-3-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 28748940 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-cyclohexyl-3-piperazin-1-ylbenzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(N2CCNCC2)c1 |
| InChI | InChI=1S/C17H25N3O/c21-17(19-15-6-2-1-3-7-15)14-5-4-8-16(13-14)20-11-9-18-10-12-20/h4-5,8,13,15,18H,1-3,6-7,9-12H2,(H,19,21) |
| InChIKey | RWAPDMFHMATZJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |