C16H20N2O4S — CID 20898578
N-cyclohexyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 20898578) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-cyclohexyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-cyclohexyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 20898578 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-cyclohexyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(N2C(=O)CCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H20N2O4S/c19-15-9-10-23(21,22)18(15)14-8-4-5-12(11-14)16(20)17-13-6-2-1-3-7-13/h4-5,8,11,13H,1-3,6-7,9-10H2,(H,17,20) |
| InChIKey | OBSVLSUUQBXKJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |