C18H18N2O4S — CID 26833741
N-[(1S)-1-phenylethyl]-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 26833741) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[(1S)-1-phenylethyl]-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 26833741 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | C[C@H](NC(=O)c1cccc(N2C(=O)CCS2(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-13(14-6-3-2-4-7-14)19-18(22)15-8-5-9-16(12-15)20-17(21)10-11-25(20,23)24/h2-9,12-13H,10-11H2,1H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | JTUJMKNWLYQJPP-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |