C19H26N2O2 — CID 4229482
N-cyclooctyl-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 4229482) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-cyclooctyl-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-cyclooctyl-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 4229482 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-cyclooctyl-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(NC1CCCCCCC1)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C19H26N2O2/c22-18-12-7-13-21(18)17-11-6-8-15(14-17)19(23)20-16-9-4-2-1-3-5-10-16/h6,8,11,14,16H,1-5,7,9-10,12-13H2,(H,20,23) |
| InChIKey | JNKGWFLYFIMGBS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |