C24H31N3O — CID 138058182
N-[1-(1-phenylethyl)piperidin-4-yl]-3-pyrrolidin-1-ylbenzamide (PubChem CID 138058182) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[1-(1-phenylethyl)piperidin-4-yl]-3-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[1-(1-phenylethyl)piperidin-4-yl]-3-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 138058182 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-[1-(1-phenylethyl)piperidin-4-yl]-3-pyrrolidin-1-ylbenzamide |
| SMILES | CC(c1ccccc1)N1CCC(NC(=O)c2cccc(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C24H31N3O/c1-19(20-8-3-2-4-9-20)26-16-12-22(13-17-26)25-24(28)21-10-7-11-23(18-21)27-14-5-6-15-27/h2-4,7-11,18-19,22H,5-6,12-17H2,1H3,(H,25,28) |
| InChIKey | OGVYERYHNIRXTJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |