C19H26N2O3 — CID 2051787
3-[4-(4-cyclohexylphenyl)piperazin-1-yl]-3-oxopropanoic acid (PubChem CID 2051787) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[4-(4-cyclohexylphenyl)piperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[4-(4-cyclohexylphenyl)piperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 2051787 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-[4-(4-cyclohexylphenyl)piperazin-1-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1CCN(c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H26N2O3/c22-18(14-19(23)24)21-12-10-20(11-13-21)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h6-9,15H,1-5,10-14H2,(H,23,24) |
| InChIKey | CPYKWDMHGXVDFJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|