C15H16Cl2F3N3O — CID 51163234
(2,2-dichloro-1-methylcyclopropyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 51163234) has the molecular formula C15H16Cl2F3N3O and a molecular weight of 382.21 g/mol. Its IUPAC name is (2,2-dichloro-1-methylcyclopropyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | (2,2-dichloro-1-methylcyclopropyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51163234 |
| Molecular Formula | C15H16Cl2F3N3O |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (2,2-dichloro-1-methylcyclopropyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C15H16Cl2F3N3O/c1-13(9-14(13,16)17)12(24)23-6-4-22(5-7-23)11-3-2-10(8-21-11)15(18,19)20/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | WXFQJYOJINPJGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|