C14H11F10N3O — CID 4530139
2,2,3,3,4,4,4-heptafluoro-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one (PubChem CID 4530139) has the molecular formula C14H11F10N3O and a molecular weight of 427.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 4530139 |
| Molecular Formula | C14H11F10N3O |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(N1CCN(c2ccc(C(F)(F)F)cn2)CC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F10N3O/c15-11(16,13(20,21)14(22,23)24)10(28)27-5-3-26(4-6-27)9-2-1-8(7-25-9)12(17,18)19/h1-2,7H,3-6H2 |
| InChIKey | OXRZEKRCICERJL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|