C15H12F10N2O — CID 91745165
2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one (PubChem CID 91745165) has the molecular formula C15H12F10N2O and a molecular weight of 426.25 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 91745165 |
| Molecular Formula | C15H12F10N2O |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(N1CCN(c2ccc(C(F)(F)F)cc2)CC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H12F10N2O/c16-12(17,14(21,22)15(23,24)25)11(28)27-7-5-26(6-8-27)10-3-1-9(2-4-10)13(18,19)20/h1-4H,5-8H2 |
| InChIKey | YUAMGTKUVJODJD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|