C12H11F7N4O — CID 3520236
2,2,3,3,4,4,4-heptafluoro-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one (PubChem CID 3520236) has the molecular formula C12H11F7N4O and a molecular weight of 360.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 3520236 |
| Molecular Formula | C12H11F7N4O |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-1-one |
| SMILES | O=C(N1CCN(c2ncccn2)CC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F7N4O/c13-10(14,11(15,16)12(17,18)19)8(24)22-4-6-23(7-5-22)9-20-2-1-3-21-9/h1-3H,4-7H2 |
| InChIKey | OGLMSODDFNIRSA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|