C18H24N8O — CID 17148603
1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethanone (PubChem CID 17148603) has the molecular formula C18H24N8O and a molecular weight of 368.44 g/mol. Its IUPAC name is 1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 17148603 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1,2-bis(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2ncccn2)CC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H24N8O/c27-16(24-11-13-26(14-12-24)18-21-5-2-6-22-18)15-23-7-9-25(10-8-23)17-19-3-1-4-20-17/h1-6H,7-15H2 |
| InChIKey | UUYPSUXHXLSGEU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 81.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |