C20H26N6O — CID 2813993
1,2-bis(4-pyridin-2-ylpiperazin-1-yl)ethanone (PubChem CID 2813993) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 1,2-bis(4-pyridin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 1,2-bis(4-pyridin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 2813993 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 1,2-bis(4-pyridin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2ccccn2)CC1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26N6O/c27-20(26-15-13-25(14-16-26)19-6-2-4-8-22-19)17-23-9-11-24(12-10-23)18-5-1-3-7-21-18/h1-8H,9-17H2 |
| InChIKey | RCTNMOZVUCZBEW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |